CAS 1190619-44-3 is the registry number for 2-Acetamido-6-azido-2,6-dideoxy-D-galactopyranose. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
N-[6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]acetamide (CAS 1190619-44-3) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: N-[6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]acetamide. InChIKey: JBCJECOTKGFRTM-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | N-[6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]acetamide |
| InChIKey | JBCJECOTKGFRTM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1O)CN=[N+]=[N-])O)O |
Computed by PubChem (NCBI)