CAS 62488-57-7 appears in our catalog under these names: Azacitidine Impurity 40, Dihydro-5-azacytidine. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one (CAS 62488-57-7) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one. InChIKey: LJIRBXZDQGQUOO-KVTDHHQDSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | 6-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,4-dihydro-1,3,5-triazin-2-one |
| InChIKey | LJIRBXZDQGQUOO-KVTDHHQDSA-N |
| SMILES | C1N=C(NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N |
Computed by PubChem (NCBI)