CAS 146912-87-0 is the registry number for 2-Acetamido-6-azido-2,6-dideoxy-D-mannose, >98.0%(HPLC). Offered by: TCI. Available pack sizes: 5mg.
N-[(3S,4R,5S,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]acetamide (CAS 146912-87-0) is a chemical compound with the molecular formula C8H14N4O5 and a molecular weight of 246.22 g/mol. IUPAC name: N-[(3S,4R,5S,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]acetamide. InChIKey: JBCJECOTKGFRTM-ZTVVOAFPSA-N.
| Molecular formula | C8H14N4O5 |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | N-[(3S,4R,5S,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]acetamide |
| InChIKey | JBCJECOTKGFRTM-ZTVVOAFPSA-N |
| SMILES | CC(=O)N[C@H]1[C@H]([C@@H]([C@H](OC1O)CN=[N+]=[N-])O)O |
Computed by PubChem (NCBI)