CAS 1190890-12-0 appears in our catalog under these names: (R)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 95%, (R)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 95+%, 95+%, Tert-butyl (R)-2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 97%, (R)-tert-Butyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride (CAS 1190890-12-0) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride. InChIKey: MQYQQPSDLQAGFQ-DDWIOCJRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | MQYQQPSDLQAGFQ-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CN.Cl |
Computed by PubChem (NCBI)