CAS 119101-24-5 is the registry number for 5-(2,3,4-Trimethoxyphenyl)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
5-(2,3,4-trimethoxyphenyl)cyclohexane-1,3-dione (CAS 119101-24-5) is a chemical compound with the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. IUPAC name: 5-(2,3,4-trimethoxyphenyl)cyclohexane-1,3-dione. InChIKey: HJRCBOQATKJKRJ-UHFFFAOYSA-N.
| Molecular formula | C15H18O5 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 5-(2,3,4-trimethoxyphenyl)cyclohexane-1,3-dione |
| InChIKey | HJRCBOQATKJKRJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C2CC(=O)CC(=O)C2)OC)OC |
Computed by PubChem (NCBI)