Products 1191059-84-3
CAS 1191059-84-3 is the registry number for [4-(5-Propyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid (CAS 1191059-84-3) is a chemical compound with the molecular formula C11H13BN2O3 and a molecular weight of 232.05 g/mol. IUPAC name: [4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid. InChIKey: HRRAVECJDVDMGY-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O3 |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | [4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]boronic acid |
| InChIKey | HRRAVECJDVDMGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NOC(=N2)CCC)(O)O |
Computed by PubChem (NCBI)