CAS 2377607-71-9 is the registry number for [1-(4-Methoxyphenyl)-3-methylpyrazol-4-yl]boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[1-(4-methoxyphenyl)-3-methylpyrazol-4-yl]boronic acid (CAS 2377607-71-9) is a chemical compound with the molecular formula C11H13BN2O3 and a molecular weight of 232.05 g/mol. IUPAC name: [1-(4-methoxyphenyl)-3-methylpyrazol-4-yl]boronic acid. InChIKey: LNQBZPCTZPDQLC-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O3 |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | [1-(4-methoxyphenyl)-3-methylpyrazol-4-yl]boronic acid |
| InChIKey | LNQBZPCTZPDQLC-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C)C2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)