CAS 2225169-63-9 is the registry number for 2–Methoxy–4–(2–methylimidazol–1–yl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg.
[2-methoxy-4-(2-methylimidazol-1-yl)phenyl]boronic acid (CAS 2225169-63-9) is a chemical compound with the molecular formula C11H13BN2O3 and a molecular weight of 232.05 g/mol. IUPAC name: [2-methoxy-4-(2-methylimidazol-1-yl)phenyl]boronic acid. InChIKey: JEQCLKKEIWOMJH-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O3 |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | [2-methoxy-4-(2-methylimidazol-1-yl)phenyl]boronic acid |
| InChIKey | JEQCLKKEIWOMJH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2C=CN=C2C)OC)(O)O |
Computed by PubChem (NCBI)