CAS 1191062-03-9 appears in our catalog under these names: 4–(2–(N–Boc–N–Methyl)aminoethyl)phenylboronic acid, 4-[2-(N-Boc-N-Methyl)aminoethyl]phenylboronic acid, 95%, 95%, 4-[2-(N-Boc-N-Methyl)aminoethyl]phenylboronic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
[4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]boronic acid (CAS 1191062-03-9) is a chemical compound with the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. IUPAC name: [4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]boronic acid. InChIKey: SHIGSPOXCDMZRV-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4 |
|---|---|
| Molecular weight | 279.14 g/mol |
| IUPAC name | [4-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]phenyl]boronic acid |
| InChIKey | SHIGSPOXCDMZRV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CCN(C)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)