CAS 1256360-07-2 appears in our catalog under these names: 1-(Isopropoxycarbonyl)pyrrole-3-boronic acid, pinacol ester, 98%, Isopropyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Propan-2-yl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate (CAS 1256360-07-2) is a chemical compound with the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. IUPAC name: propan-2-yl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate. InChIKey: MSGYSVHMKDSIFV-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO4 |
|---|---|
| Molecular weight | 279.14 g/mol |
| IUPAC name | propan-2-yl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate |
| InChIKey | MSGYSVHMKDSIFV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C(=O)OC(C)C |
Computed by PubChem (NCBI)