CAS 119153-93-4 is the registry number for N-(N-benzyloxycarbonyl-D-valyl)-D-valine. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-3-methyl-2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanoic acid (CAS 119153-93-4) is a chemical compound with the molecular formula C18H26N2O5 and a molecular weight of 350.4 g/mol. IUPAC name: (2R)-3-methyl-2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanoic acid. InChIKey: BAIDNIBSOZLYQU-HUUCEWRRSA-N.
| Molecular formula | C18H26N2O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (2R)-3-methyl-2-[[(2R)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]butanoic acid |
| InChIKey | BAIDNIBSOZLYQU-HUUCEWRRSA-N |
| SMILES | CC(C)[C@H](C(=O)N[C@H](C(C)C)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)