CAS 119162-58-2 appears in our catalog under these names: 3-Benzylisoxazol-5-amine, 95+%, 3-Benzyl-1,2-oxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-benzyl-1,2-oxazol-5-amine (CAS 119162-58-2) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 3-benzyl-1,2-oxazol-5-amine. InChIKey: PJEXDUCPZGTNTP-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3-benzyl-1,2-oxazol-5-amine |
| InChIKey | PJEXDUCPZGTNTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NOC(=C2)N |
Computed by PubChem (NCBI)