Products 119162-59-3
CAS 119162-59-3 appears in our catalog under these names: 3-Phenethylisoxazol-5-amine, 95+%, 3-(2-Phenylethyl)-1,2-oxazol-5-amine, 3-(2-Phenylethyl)-1,2-oxazol-5-amine, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg.
3-(2-phenylethyl)-1,2-oxazol-5-amine (CAS 119162-59-3) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 3-(2-phenylethyl)-1,2-oxazol-5-amine. InChIKey: NZGZLQLPYDXMJG-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 3-(2-phenylethyl)-1,2-oxazol-5-amine |
| InChIKey | NZGZLQLPYDXMJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=NOC(=C2)N |
Computed by PubChem (NCBI)