CAS 119179-46-3 appears in our catalog under these names: 1-(Benzo(d)(1,3)dioxol-5-yl)urea, 95+%, (1,3-Dioxaindan-5-yl)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1,3-benzodioxol-5-ylurea (CAS 119179-46-3) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 1,3-benzodioxol-5-ylurea. InChIKey: RWDRRVXXFFXKMM-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,3-benzodioxol-5-ylurea |
| InChIKey | RWDRRVXXFFXKMM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)N |
Computed by PubChem (NCBI)