Products 1191937-43-5
CAS 1191937-43-5 is the registry number for AHR agonist 10. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(E)-2-(4-methoxyphenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol (CAS 1191937-43-5) is a chemical compound with the molecular formula C18H20O3 and a molecular weight of 284.3 g/mol. IUPAC name: 5-[(E)-2-(4-methoxyphenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol. InChIKey: KUQNTALYTKISGY-SNAWJCMRSA-N.
| Molecular formula | C18H20O3 |
|---|---|
| Molecular weight | 284.3 g/mol |
| IUPAC name | 5-[(E)-2-(4-methoxyphenyl)ethenyl]-2-propan-2-ylbenzene-1,3-diol |
| InChIKey | KUQNTALYTKISGY-SNAWJCMRSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1O)/C=C/C2=CC=C(C=C2)OC)O |
Computed by PubChem (NCBI)