CAS 119222-40-1 is the registry number for 5-Amino-1-((4-fluorophenyl)methyl)-1H-1,2,3-triazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide (CAS 119222-40-1) is a chemical compound with the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. IUPAC name: 5-amino-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide. InChIKey: ZWIBDSZNIQGBHX-UHFFFAOYSA-N.
| Molecular formula | C10H10FN5O |
|---|---|
| Molecular weight | 235.22 g/mol |
| IUPAC name | 5-amino-1-[(4-fluorophenyl)methyl]triazole-4-carboxamide |
| InChIKey | ZWIBDSZNIQGBHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=C(N=N2)C(=O)N)N)F |
Computed by PubChem (NCBI)