CAS 1255791-10-6 is the registry number for 1-(3-Fluorobenzyl)-n'-hydroxy-1h-1,2,3-triazole-4-carboximidamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(3-fluorophenyl)methyl]-N'-hydroxytriazole-4-carboximidamide (CAS 1255791-10-6) is a chemical compound with the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]-N'-hydroxytriazole-4-carboximidamide. InChIKey: VVGMENTXEVJNNQ-UHFFFAOYSA-N.
| Molecular formula | C10H10FN5O |
|---|---|
| Molecular weight | 235.22 g/mol |
| IUPAC name | 1-[(3-fluorophenyl)methyl]-N'-hydroxytriazole-4-carboximidamide |
| InChIKey | VVGMENTXEVJNNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CN2C=C(N=N2)/C(=N/O)/N |
Computed by PubChem (NCBI)