CAS 618070-67-0 appears in our catalog under these names: 5-Amino-1-(4-fluorophenyl)-1h-pyrazole-4-carbohydrazide, 95%, 5-Amino-1-(4-fluorophenyl)-1H-pyrazole-4-carbohydrazide, 99%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
5-amino-1-(4-fluorophenyl)pyrazole-4-carbohydrazide (CAS 618070-67-0) is a chemical compound with the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. IUPAC name: 5-amino-1-(4-fluorophenyl)pyrazole-4-carbohydrazide. InChIKey: IJFYSKITNXVZJE-UHFFFAOYSA-N.
| Molecular formula | C10H10FN5O |
|---|---|
| Molecular weight | 235.22 g/mol |
| IUPAC name | 5-amino-1-(4-fluorophenyl)pyrazole-4-carbohydrazide |
| InChIKey | IJFYSKITNXVZJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=C(C=N2)C(=O)NN)N)F |
Computed by PubChem (NCBI)