CAS 1192347-88-8 is the registry number for 4-Fluoro-3-(methylsulfonyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(bromomethyl)-1-fluoro-2-methylsulfonylbenzene (CAS 1192347-88-8) is a chemical compound with the molecular formula C8H8BrFO2S and a molecular weight of 267.12 g/mol. IUPAC name: 4-(bromomethyl)-1-fluoro-2-methylsulfonylbenzene. InChIKey: QBVVLSGKJVQKTJ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrFO2S |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 4-(bromomethyl)-1-fluoro-2-methylsulfonylbenzene |
| InChIKey | QBVVLSGKJVQKTJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)CBr)F |
Computed by PubChem (NCBI)