Products 2921865-65-6
CAS 2921865-65-6 is the registry number for 1-bromo-2-fluoro-5-methyl-3-(methylsulfonyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-bromo-2-fluoro-5-methyl-3-methylsulfonylbenzene (CAS 2921865-65-6) is a chemical compound with the molecular formula C8H8BrFO2S and a molecular weight of 267.12 g/mol. IUPAC name: 1-bromo-2-fluoro-5-methyl-3-methylsulfonylbenzene. InChIKey: MUFSNYIQQRXRQC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrFO2S |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 1-bromo-2-fluoro-5-methyl-3-methylsulfonylbenzene |
| InChIKey | MUFSNYIQQRXRQC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)F)S(=O)(=O)C |
Computed by PubChem (NCBI)