CAS 1240287-83-5 is the registry number for 2-Bromo-4-(ethylsulfonyl)-1-fluorobenzene, 95%. Offered by: Ambeed. Available pack sizes: 1g.
2-bromo-4-ethylsulfonyl-1-fluorobenzene (CAS 1240287-83-5) is a chemical compound with the molecular formula C8H8BrFO2S and a molecular weight of 267.12 g/mol. IUPAC name: 2-bromo-4-ethylsulfonyl-1-fluorobenzene. InChIKey: WINYKRJPNRQKIW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrFO2S |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 2-bromo-4-ethylsulfonyl-1-fluorobenzene |
| InChIKey | WINYKRJPNRQKIW-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)