Products 1192548-13-2
CAS 1192548-13-2 appears in our catalog under these names: Methyl 4-iodo-3,5-dimethylbenzoate, 97%+(GC-MS),RG, Methyl 4-Iodo-3，5-Dimethylbenzoate, 97%+(GC-MS),RG. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Methyl 4-iodo-3,5-dimethylbenzoate (CAS 1192548-13-2) is a chemical compound with the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. IUPAC name: methyl 4-iodo-3,5-dimethylbenzoate. InChIKey: MFHFFQURHRUQRN-UHFFFAOYSA-N.
| Molecular formula | C10H11IO2 |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | methyl 4-iodo-3,5-dimethylbenzoate |
| InChIKey | MFHFFQURHRUQRN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1I)C)C(=O)OC |
Computed by PubChem (NCBI)