CAS 1192586-35-8 is the registry number for DS44470011. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[5-hydroxy-6-methyl-2-[(4-phenylphenyl)methyl]pyrimidine-4-carbonyl]amino]acetic acid (CAS 1192586-35-8) is a chemical compound with the molecular formula C21H19N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: 2-[[5-hydroxy-6-methyl-2-[(4-phenylphenyl)methyl]pyrimidine-4-carbonyl]amino]acetic acid. InChIKey: RNJLQAHYMHEWME-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-[[5-hydroxy-6-methyl-2-[(4-phenylphenyl)methyl]pyrimidine-4-carbonyl]amino]acetic acid |
| InChIKey | RNJLQAHYMHEWME-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)CC2=CC=C(C=C2)C3=CC=CC=C3)C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)