CAS 1423035-44-2 is the registry number for Methyl 2-deoxy-5-o-toluoyl-l-ribofuranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[(2S,3R)-3-hydroxy-5-methoxyoxolan-2-yl]methyl 2-methylbenzoate (CAS 1423035-44-2) is a chemical compound with the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. IUPAC name: [(2S,3R)-3-hydroxy-5-methoxyoxolan-2-yl]methyl 2-methylbenzoate. InChIKey: HVQZNFUZXQIVDP-OJRHAOMCSA-N.
| Molecular formula | C14H18O5 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | [(2S,3R)-3-hydroxy-5-methoxyoxolan-2-yl]methyl 2-methylbenzoate |
| InChIKey | HVQZNFUZXQIVDP-OJRHAOMCSA-N |
| SMILES | CC1=CC=CC=C1C(=O)OC[C@H]2[C@@H](CC(O2)OC)O |
Computed by PubChem (NCBI)