Products 1193387-63-1

CAS 1193387-63-1 is the registry number for 6-azabicyclo(3.2.1)octane-5-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

6-azabicyclo[3.2.1]octane-5-carboxylic acid;hydrochloride (CAS 1193387-63-1) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 6-azabicyclo[3.2.1]octane-5-carboxylic acid;hydrochloride. InChIKey: OWRHKHRQZNLOFL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC name6-azabicyclo[3.2.1]octane-5-carboxylic acid;hydrochloride
InChIKeyOWRHKHRQZNLOFL-UHFFFAOYSA-N
SMILESC1CC2CC(C1)(NC2)C(=O)O.Cl

Computed by PubChem (NCBI)