CAS 882182-42-5 is the registry number for (1R,5S)-6-azabicyclo(3.2.1)octane-5-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(1R,5S)-6-azabicyclo[3.2.1]octane-5-carboxylic acid;hydrochloride (CAS 882182-42-5) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1R,5S)-6-azabicyclo[3.2.1]octane-5-carboxylic acid;hydrochloride. InChIKey: OWRHKHRQZNLOFL-HNJRQZNRSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1R,5S)-6-azabicyclo[3.2.1]octane-5-carboxylic acid;hydrochloride |
| InChIKey | OWRHKHRQZNLOFL-HNJRQZNRSA-N |
| SMILES | C1C[C@@H]2C[C@](C1)(NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)