Products 1193387-98-2
CAS 1193387-98-2 appears in our catalog under these names: 6-Nitro-3,4-dihydro-2H-1,4-benzothiazine, 6-nitro-3,4-dihydro-2H-1,4-benzothiazine, 97%(LC-MS),RG, 97%(LC-MS),RG, 6-NITRO-3,4-DIHYDRO-2H-BENZO[B][1,4]THIAZINE, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g.
6-nitro-3,4-dihydro-2H-1,4-benzothiazine (CAS 1193387-98-2) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 6-nitro-3,4-dihydro-2H-1,4-benzothiazine. InChIKey: VZTWUNMNDBPKKX-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 6-nitro-3,4-dihydro-2H-1,4-benzothiazine |
| InChIKey | VZTWUNMNDBPKKX-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(N1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)