CAS 1193388-21-4 appears in our catalog under these names: 3-(4-Bromothiophen-2-yl)-5-(chloromethyl)-1,2,4-oxadiazole, 95%, 3-(4-Bromothiophen-2-yl)-5-(chloromethyl)-1,2,4-oxadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(4-bromothiophen-2-yl)-5-(chloromethyl)-1,2,4-oxadiazole (CAS 1193388-21-4) is a chemical compound with the molecular formula C7H4BrClN2OS and a molecular weight of 279.54 g/mol. IUPAC name: 3-(4-bromothiophen-2-yl)-5-(chloromethyl)-1,2,4-oxadiazole. InChIKey: DLOQLOKVVHKINF-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2OS |
|---|---|
| Molecular weight | 279.54 g/mol |
| IUPAC name | 3-(4-bromothiophen-2-yl)-5-(chloromethyl)-1,2,4-oxadiazole |
| InChIKey | DLOQLOKVVHKINF-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1Br)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)