CAS 1330782-89-2 is the registry number for 6-Bromo-2-(chloromethyl)thieno[3,2-d]pyrimidin-4(3H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-(chloromethyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1330782-89-2) is a chemical compound with the molecular formula C7H4BrClN2OS and a molecular weight of 279.54 g/mol. IUPAC name: 6-bromo-2-(chloromethyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: SFTAUIWAQBLPFD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2OS |
|---|---|
| Molecular weight | 279.54 g/mol |
| IUPAC name | 6-bromo-2-(chloromethyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | SFTAUIWAQBLPFD-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1N=C(NC2=O)CCl)Br |
Computed by PubChem (NCBI)