CAS 848658-82-2 appears in our catalog under these names: 2-(5-Bromothiophen-2-yl)-5-(chloromethyl)-1,3,4-oxadiazole, 2-(5-Bromothien-2-yl)-5-(chloromethyl)-1,3,4-oxadiazole, 95%, 2-(5-Bromothiophen-2-yl)-5-(chloromethyl)-1,3,4-oxadiazole, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 10g, 1g, 5g.
2-(5-bromothiophen-2-yl)-5-(chloromethyl)-1,3,4-oxadiazole (CAS 848658-82-2) is a chemical compound with the molecular formula C7H4BrClN2OS and a molecular weight of 279.54 g/mol. IUPAC name: 2-(5-bromothiophen-2-yl)-5-(chloromethyl)-1,3,4-oxadiazole. InChIKey: KSHMYYGVWCHTTB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2OS |
|---|---|
| Molecular weight | 279.54 g/mol |
| IUPAC name | 2-(5-bromothiophen-2-yl)-5-(chloromethyl)-1,3,4-oxadiazole |
| InChIKey | KSHMYYGVWCHTTB-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)