CAS 1193388-44-1 appears in our catalog under these names: 1-Benzylpyrrolidine-3-sulfonyl fluoride, 1-Benzylpyrrolidine-3-sulfonyl fluoride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
1-benzylpyrrolidine-3-sulfonyl fluoride (CAS 1193388-44-1) is a chemical compound with the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. IUPAC name: 1-benzylpyrrolidine-3-sulfonyl fluoride. InChIKey: KCLJEZPHJZQPIW-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2S |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-benzylpyrrolidine-3-sulfonyl fluoride |
| InChIKey | KCLJEZPHJZQPIW-UHFFFAOYSA-N |
| SMILES | C1CN(CC1S(=O)(=O)F)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)