CAS 312-32-3 is the registry number for 1-(4-Fluorophenylsulfonyl)piperidine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
1-(4-fluorophenyl)sulfonylpiperidine (CAS 312-32-3) is a chemical compound with the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonylpiperidine. InChIKey: DZARDDKGQWNMKA-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2S |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonylpiperidine |
| InChIKey | DZARDDKGQWNMKA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)