CAS 2151443-18-2 appears in our catalog under these names: 4-(2-fluorophenyl)tetrahydro-2H-thiopyran-4-amine 1,1-dioxide, 95%, 4-Amino-4-(2-fluorophenyl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-(2-fluorophenyl)-1,1-dioxothian-4-amine (CAS 2151443-18-2) is a chemical compound with the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. IUPAC name: 4-(2-fluorophenyl)-1,1-dioxothian-4-amine. InChIKey: KQTKZKQPUGROCJ-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2S |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-1,1-dioxothian-4-amine |
| InChIKey | KQTKZKQPUGROCJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1(C2=CC=CC=C2F)N |
Computed by PubChem (NCBI)