CAS 1193389-59-1 is the registry number for 4-(1-Aminoethyl)-n,n-diethylbenzene-1-sulfonamide hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
4-(1-aminoethyl)-N,N-diethylbenzenesulfonamide;hydrochloride (CAS 1193389-59-1) is a chemical compound with the molecular formula C12H21ClN2O2S and a molecular weight of 292.83 g/mol. IUPAC name: 4-(1-aminoethyl)-N,N-diethylbenzenesulfonamide;hydrochloride. InChIKey: OMZMWFQEOQCULA-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2O2S |
|---|---|
| Molecular weight | 292.83 g/mol |
| IUPAC name | 4-(1-aminoethyl)-N,N-diethylbenzenesulfonamide;hydrochloride |
| InChIKey | OMZMWFQEOQCULA-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C(C)N.Cl |
Computed by PubChem (NCBI)