CAS 1836159-29-5 is the registry number for N-(3-Aminopropyl)-2,4,6-trimethylbenzenesulfonamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-aminopropyl)-2,4,6-trimethylbenzenesulfonamide;hydrochloride (CAS 1836159-29-5) is a chemical compound with the molecular formula C12H21ClN2O2S and a molecular weight of 292.83 g/mol. IUPAC name: N-(3-aminopropyl)-2,4,6-trimethylbenzenesulfonamide;hydrochloride. InChIKey: OYBKBGCFTGKODG-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2O2S |
|---|---|
| Molecular weight | 292.83 g/mol |
| IUPAC name | N-(3-aminopropyl)-2,4,6-trimethylbenzenesulfonamide;hydrochloride |
| InChIKey | OYBKBGCFTGKODG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NCCCN)C.Cl |
Computed by PubChem (NCBI)