CAS 1835482-87-5 is the registry number for N-(4-Aminobutyl)-2,5-dimethylbenzenesulfonamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-aminobutyl)-2,5-dimethylbenzenesulfonamide;hydrochloride (CAS 1835482-87-5) is a chemical compound with the molecular formula C12H21ClN2O2S and a molecular weight of 292.83 g/mol. IUPAC name: N-(4-aminobutyl)-2,5-dimethylbenzenesulfonamide;hydrochloride. InChIKey: HUKKSTPKFWQPMB-UHFFFAOYSA-N.
| Molecular formula | C12H21ClN2O2S |
|---|---|
| Molecular weight | 292.83 g/mol |
| IUPAC name | N-(4-aminobutyl)-2,5-dimethylbenzenesulfonamide;hydrochloride |
| InChIKey | HUKKSTPKFWQPMB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NCCCCN.Cl |
Computed by PubChem (NCBI)