CAS 1193389-87-5 appears in our catalog under these names: 6-Amino-2,3-dihydro-1H-indole-1-sulfonamide hydrochloride, 95%, 6-Amino-2,3-dihydro-1H-indole-1-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-amino-2,3-dihydroindole-1-sulfonamide;hydrochloride (CAS 1193389-87-5) is a chemical compound with the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. IUPAC name: 6-amino-2,3-dihydroindole-1-sulfonamide;hydrochloride. InChIKey: RAZHKCAFNWSFHW-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O2S |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 6-amino-2,3-dihydroindole-1-sulfonamide;hydrochloride |
| InChIKey | RAZHKCAFNWSFHW-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=CC(=C2)N)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)