Products 1807885-03-5
CAS 1807885-03-5 is the registry number for (2R)-N-(4-Acetyl-1,3-thiazol-2-yl)-2-aminopropanamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2R)-N-(4-acetyl-1,3-thiazol-2-yl)-2-aminopropanamide;hydrochloride (CAS 1807885-03-5) is a chemical compound with the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. IUPAC name: (2R)-N-(4-acetyl-1,3-thiazol-2-yl)-2-aminopropanamide;hydrochloride. InChIKey: PNHBRMKLVIXIBV-PGMHMLKASA-N.
| Molecular formula | C8H12ClN3O2S |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | (2R)-N-(4-acetyl-1,3-thiazol-2-yl)-2-aminopropanamide;hydrochloride |
| InChIKey | PNHBRMKLVIXIBV-PGMHMLKASA-N |
| SMILES | C[C@H](C(=O)NC1=NC(=CS1)C(=O)C)N.Cl |
Computed by PubChem (NCBI)