CAS 1607276-71-0 is the registry number for 1-(2-Aminoethyl)-1,3-dihydro-2,1,3-benzothiadiazole-2,2-dione hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,2-dioxo-1H-2lambda6,1,3-benzothiadiazol-3-yl)ethanamine;hydrochloride (CAS 1607276-71-0) is a chemical compound with the molecular formula C8H12ClN3O2S and a molecular weight of 249.72 g/mol. IUPAC name: 2-(2,2-dioxo-1H-2lambda6,1,3-benzothiadiazol-3-yl)ethanamine;hydrochloride. InChIKey: MODASJXENAYLLO-UHFFFAOYSA-N.
| Molecular formula | C8H12ClN3O2S |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 2-(2,2-dioxo-1H-2lambda6,1,3-benzothiadiazol-3-yl)ethanamine;hydrochloride |
| InChIKey | MODASJXENAYLLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NS(=O)(=O)N2CCN.Cl |
Computed by PubChem (NCBI)