Products 1193389-99-9
CAS 1193389-99-9 is the registry number for 2-Methylpyrazolo(1,5-a)pyrimidine-6-carbothioamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide (CAS 1193389-99-9) is a chemical compound with the molecular formula C8H8N4S and a molecular weight of 192.24 g/mol. IUPAC name: 2-methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide. InChIKey: FTVJXALHBNWTDO-UHFFFAOYSA-N.
| Molecular formula | C8H8N4S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 2-methylpyrazolo[1,5-a]pyrimidine-6-carbothioamide |
| InChIKey | FTVJXALHBNWTDO-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(C=NC2=C1)C(=S)N |
Computed by PubChem (NCBI)