CAS 1193390-29-2 is the registry number for 2-(Furan-3-yl)-1H-1,3-benzodiazol-5-amine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(furan-3-yl)-3H-benzimidazol-5-amine;dihydrochloride (CAS 1193390-29-2) is a chemical compound with the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. IUPAC name: 2-(furan-3-yl)-3H-benzimidazol-5-amine;dihydrochloride. InChIKey: MTNWFRGQDJUZSW-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3O |
|---|---|
| Molecular weight | 272.13 g/mol |
| IUPAC name | 2-(furan-3-yl)-3H-benzimidazol-5-amine;dihydrochloride |
| InChIKey | MTNWFRGQDJUZSW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC(=N2)C3=COC=C3.Cl.Cl |
Computed by PubChem (NCBI)