CAS 1825308-53-9 is the registry number for 4,6-Dichloro-1-(tetrahydro-2H-pyran-2-yl)-1H-pyrazolo[4,3-c]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine (CAS 1825308-53-9) is a chemical compound with the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. IUPAC name: 4,6-dichloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine. InChIKey: YIEXZLJFOIFWEG-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3O |
|---|---|
| Molecular weight | 272.13 g/mol |
| IUPAC name | 4,6-dichloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridine |
| InChIKey | YIEXZLJFOIFWEG-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=NC(=C3C=N2)Cl)Cl |
Computed by PubChem (NCBI)