CAS 680216-25-5 is the registry number for 1-(3-(2,6-Dichlorophenyl)-1,2,4-oxadiazol-5-yl)-N,N-dimethylmethanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylmethanamine (CAS 680216-25-5) is a chemical compound with the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. IUPAC name: 1-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylmethanamine. InChIKey: NDJKXVVIHNEDAI-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2N3O |
|---|---|
| Molecular weight | 272.13 g/mol |
| IUPAC name | 1-[3-(2,6-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N,N-dimethylmethanamine |
| InChIKey | NDJKXVVIHNEDAI-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC(=NO1)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)