CAS 1193390-60-1 appears in our catalog under these names: 2-(Dichloromethyl)imidazo(1,2-a)pyridine hydrochloride, 95%, 2-(Dichloromethyl)imidazo(1,2-a)pyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(dichloromethyl)imidazo[1,2-a]pyridine;hydrochloride (CAS 1193390-60-1) is a chemical compound with the molecular formula C8H7Cl3N2 and a molecular weight of 237.5 g/mol. IUPAC name: 2-(dichloromethyl)imidazo[1,2-a]pyridine;hydrochloride. InChIKey: QMCXXXOZPLWPGC-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2 |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 2-(dichloromethyl)imidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | QMCXXXOZPLWPGC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C(Cl)Cl.Cl |
Computed by PubChem (NCBI)