CAS 1240528-10-2 appears in our catalog under these names: 2-Amino-2-(3,5-dichlorophenyl)acetonitrile hydrochloride, 2-Amino-2-(3,5-dichlorophenyl)acetonitrile hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
2-amino-2-(3,5-dichlorophenyl)acetonitrile;hydrochloride (CAS 1240528-10-2) is a chemical compound with the molecular formula C8H7Cl3N2 and a molecular weight of 237.5 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)acetonitrile;hydrochloride. InChIKey: IOIPVALHMXRHBW-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2 |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 2-amino-2-(3,5-dichlorophenyl)acetonitrile;hydrochloride |
| InChIKey | IOIPVALHMXRHBW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C#N)N.Cl |
Computed by PubChem (NCBI)