CAS 40658-56-8 appears in our catalog under these names: 2-Amino-2-(2,6-dichlorophenyl)acetonitrile hydrochloride, 95%, 2-Amino-2-(2,6-dichlorophenyl)acetonitrile hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-amino-2-(2,6-dichlorophenyl)acetonitrile;hydrochloride (CAS 40658-56-8) is a chemical compound with the molecular formula C8H7Cl3N2 and a molecular weight of 237.5 g/mol. IUPAC name: 2-amino-2-(2,6-dichlorophenyl)acetonitrile;hydrochloride. InChIKey: QSHUFYUQFXAUMH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3N2 |
|---|---|
| Molecular weight | 237.5 g/mol |
| IUPAC name | 2-amino-2-(2,6-dichlorophenyl)acetonitrile;hydrochloride |
| InChIKey | QSHUFYUQFXAUMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C#N)N)Cl.Cl |
Computed by PubChem (NCBI)