CAS 119392-95-9 appears in our catalog under these names: (R)-(+)-N,N-Dimethyl-1-(1-naphthyl)ethylamine, 98%, (R)-(+)-N,N-DIMETHYL-1-(1-NAPHTHYL)ETHY&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 1G.
(1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine (CAS 119392-95-9) is a chemical compound with the molecular formula C14H17N and a molecular weight of 199.29 g/mol. IUPAC name: (1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine. InChIKey: AXRXYILTIWBHEP-LLVKDONJSA-N.
| Molecular formula | C14H17N |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | (1R)-N,N-dimethyl-1-naphthalen-1-ylethanamine |
| InChIKey | AXRXYILTIWBHEP-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N(C)C |
Computed by PubChem (NCBI)