Products 119397-06-7
CAS 119397-06-7 is the registry number for 4-Bromo-DL-phenylglycine, 95% . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 1g.
2-amino-2-(4-bromophenyl)acetic acid (CAS 119397-06-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-2-(4-bromophenyl)acetic acid. InChIKey: APLQICUORRMFHY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-2-(4-bromophenyl)acetic acid |
| InChIKey | APLQICUORRMFHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)N)Br |
Computed by PubChem (NCBI)
Synonyms:
2-amino-2-(4-bromophenyl)acetic Acid, amino(4-bromophenyl)acetic acid, (+)-2-Amino-2-(4-bromophenyl)acetic acid, 2-Amino-2-(4-bromophenyl)aceticacid, Benzeneacetic acid, alpha-amino-4-bromo-, 2-Amino-2-(4-Bromophenyl)Acetic, 2-(4-Bromophenyl)glycine, R-4-Bromophenylglycine, Amino-(4-bromo-phenyl)-acetic acid, 2-amino-2-(4-bromophenyl) acetic acid