Products 119410-04-7
CAS 119410-04-7 appears in our catalog under these names: Desloratadine Impurity 44, Desloratadine Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one (CAS 119410-04-7) is a chemical compound with the molecular formula C19H17ClN2O and a molecular weight of 324.8 g/mol. IUPAC name: 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one. InChIKey: GUXVBLYIIGICFV-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-one |
| InChIKey | GUXVBLYIIGICFV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1=C2C3=C(C=C(C=C3)Cl)C(=O)CC4=C2N=CC=C4 |
Computed by PubChem (NCBI)