Products 361197-68-4
CAS 361197-68-4 is the registry number for 11-(2-Chlorophenyl)-2,3,4,5,10,11-hexahydro-1H-dibenzo(b,e)(1,4)diazepin-1-one. Offered by: TRC. Available pack sizes: 5g.
6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (CAS 361197-68-4) is a chemical compound with the molecular formula C19H17ClN2O and a molecular weight of 324.8 g/mol. IUPAC name: 6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one. InChIKey: OXVBEDXJGHHHGT-UHFFFAOYSA-N.
| Molecular formula | C19H17ClN2O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| InChIKey | OXVBEDXJGHHHGT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(NC3=CC=CC=C3N2)C4=CC=CC=C4Cl)C(=O)C1 |
Computed by PubChem (NCBI)